
26299-14-9
| Name | Pyridinium chlorochromate |
| CAS | 26299-14-9 |
| EINECS(EC#) | 247-595-5 |
| Molecular Formula | C5H6ClCrNO3 |
| MDL Number | MFCD00013106 |
| Molecular Weight | 215.56 |
| MOL File | 26299-14-9.mol |
Chemical Properties
| Appearance | orange crystalline powder |
| Melting point | 205-208 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | Soluble in acetone, benzene, dichloromethane, acetonitrile and tetrahydrofuran. |
| form | Crystalline Powder |
| color | Orange |
| Stability: | Stable. May react with easily oxidized materials. Incompatible with reducing agents, combustible material, metals, strong reducing agents. |
| Sensitive | Moisture Sensitive |
| Merck | 14,7974 |
| BRN | 7054643 |
| Exposure limits | OSHA: Ceiling 0.1 mg/m3 NIOSH: IDLH 15 mg/m3; TWA 0.0002 mg/m3 |
| InChI | InChI=1S/C5H5N.ClH.Cr.3O/c1-2-4-6-5-3-1;;;;;/h1-5H;1H;;;; |
| InChIKey | LEHBURLTIWGHEM-UHFFFAOYSA-N |
| SMILES | C1=CC=NC=C1.[Cr](=O)(=O)(=O)[Cl-].[H+] |
| CAS DataBase Reference | 26299-14-9(CAS DataBase Reference) |
| EPA Substance Registry System | 26299-14-9(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS03,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H272-H317-H350i-H410 |
| Precautionary statements | P201-P210-P273-P280-P302+P352-P308+P313 |
| Hazard Codes | O,T,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1479 5.1/PG 2 |
| WGK Germany | 2 |
| TSCA | Yes |
| HazardClass | 5.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Inhalation Ox. Sol. 2 Skin Sens. 1 |





