2622-05-1
| Name | Allylmagnesium chloride |
| CAS | 2622-05-1 |
| EINECS(EC#) | 220-067-1 |
| Molecular Formula | C3H5ClMg |
| MDL Number | MFCD00000473 |
| Molecular Weight | 100.83 |
| MOL File | 2622-05-1.mol |
Chemical Properties
| Appearance | clear tan to brown, amber, dark grey, dark green |
| Melting point | -21°C |
| Boiling point | 66°C |
| density | 0.995 g/mL at 25 °C |
| Fp | 1 °F |
| storage temp. | water-free area |
| form | Liquid |
| color | Clear tan to brown, amber, dark gray, dark green or black |
| Water Solubility | vigorous reaction |
| Sensitive | Air & Moisture Sensitive |
| BRN | 3587316 |
| InChI | InChI=1S/C3H5.ClH.Mg/c1-3-2;;/h3H,1-2H2;1H;/q;;+1/p-1 |
| InChIKey | PLYLAFITHJUEGX-UHFFFAOYSA-M |
| SMILES | C([Mg]Cl)C=C |
| EPA Substance Registry System | Magnesium, chloro-2-propenyl-(2622-05-1) |
Safety Data
| Symbol(GHS) |     GHS02,GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H371-H372-H225-H250-H260-H314-H335-H351-H261-H303-H318-H333 |
| Precautionary statements | P223-P233-P240-P241+P242+P243-P260-P264-P270-P271-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P308+P311-P335+P334-P402+P404-P303+P361+P353-P405-P501a-P210-P231+P232-P280-P305+P351+P338-P370+P378-P422 |
| Hazard Codes | F,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3399 4.3/PG 1 |
| WGK Germany | 1 |
| F | 1-3-10 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 4.2 |
| PackingGroup | I |
| HS Code | 29319090 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Carc. 2 Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B STOT SE 3 Water-react 1 |