
2589-71-1
| Name | 4-Hydroxyvalerophenone |
| CAS | 2589-71-1 |
| EINECS(EC#) | 219-978-7 |
| Molecular Formula | C11H14O2 |
| MDL Number | MFCD00009719 |
| Molecular Weight | 178.23 |
| MOL File | 2589-71-1.mol |
Chemical Properties
| Appearance | white to light beige powder |
| Melting point | 62-65 °C |
| Boiling point | 182-183 °C/3 mmHg(lit.) |
| density | 1.0292 (rough estimate) |
| refractive index | 1.5390 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 8.13±0.15(Predicted) |
| color | White to Orange to Green |
| Usage | Intermediates of Liquid Crystals |
| Detection Methods | GC |
| InChI | InChI=1S/C11H14O2/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8,12H,2-4H2,1H3 |
| InChIKey | ZKCJJGOOPOIZTE-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(O)C=C1)(=O)CCCC |
| CAS DataBase Reference | 2589-71-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Pentanone, 1-(4-hydroxyphenyl)-(2589-71-1) |
| EPA Substance Registry System | 2589-71-1(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29182900 |
