
25717-80-0
Name | Molsidomine |
CAS | 25717-80-0 |
EINECS(EC#) | 247-207-4 |
Molecular Formula | C7H8N2O4 |
MDL Number | MFCD00869301 |
Molecular Weight | 184.15 |
MOL File | 25717-80-0.mol |
Chemical Properties
Melting point | 140-141°C |
Boiling point | 385.05°C (rough estimate) |
density | 1.3186 (rough estimate) |
refractive index | 1.6300 (estimate) |
storage temp. | 2-8°C |
solubility | Sparingly soluble in water, soluble in anhydrous ethanol and in methylene chloride. |
form | neat |
pka | pK (100°) 3.0 ± 0.1 |
color | White to Off-White |
λmax | 317nm(MeOH)(lit.) |
Merck | 14,6234 |
InChI | InChI=1S/C9H14N4O4/c1-2-16-9(14)10-8-7-13(11-17-8)12-3-5-15-6-4-12/h7H,2-6H2,1H3/b10-8- |
InChIKey | XLFWDASMENKTKL-NTMALXAHSA-N |
SMILES | [N+]1([N-]O/C(=N\C(=O)OCC)/C=1)N1CCOCC1 |
CAS DataBase Reference | 25717-80-0(CAS DataBase Reference) |
Safety Data
Hazard Codes | Xn |
Risk Statements | |
Safety Statements | |
WGK Germany | 3 |
RTECS | WU7677400 |
HS Code | 29349990 |
Toxicity |