
2571-39-3
| Name | 3,4-Dimethylbenzophenone |
| CAS | 2571-39-3 |
| EINECS(EC#) | 219-916-9 |
| Molecular Formula | C15H14O |
| MDL Number | MFCD00008525 |
| Molecular Weight | 210.27 |
| MOL File | 2571-39-3.mol |
Chemical Properties
| Melting point | 45-47 °C (lit.) |
| Boiling point | 335°C |
| density | 1.0232 (rough estimate) |
| refractive index | 1.5361 (estimate) |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 1952043 |
| InChI | InChI=1S/C15H14O/c1-11-8-9-14(10-12(11)2)15(16)13-6-4-3-5-7-13/h3-10H,1-2H3 |
| InChIKey | JENOLWCGNVWTJN-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C)C(C)=C1)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 2571-39-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4-Dimethylbenzophenone(2571-39-3) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29143990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
