
2516-95-2
| Name | 5-Chloro-2-nitrobenzoic acid |
| CAS | 2516-95-2 |
| EINECS(EC#) | 219-738-1 |
| Molecular Formula | C7H4ClNO4 |
| MDL Number | MFCD00007290 |
| Molecular Weight | 201.56 |
| MOL File | 2516-95-2.mol |
Chemical Properties
| Appearance | light yellow to yellowish-green crystalline powder |
| Melting point | 137-139 °C (lit.) |
| Boiling point | 160.5°C (rough estimate) |
| density | 1,608g/cm |
| refractive index | 1.6000 (estimate) |
| Fp | 100 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 9.67g/l |
| form | Crystalline Powder |
| pka | 1.86±0.25(Predicted) |
| color | Light yellow to yellow-green |
| Water Solubility | SLIGHTLY SOLUBLE |
| BRN | 1963952 |
| InChI | 1S/C7H4ClNO4/c8-4-1-2-6(9(12)13)5(3-4)7(10)11/h1-3H,(H,10,11) |
| InChIKey | ZKUYSJHXBFFGPU-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(Cl)ccc1[N+]([O-])=O |
| CAS DataBase Reference | 2516-95-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Chloro-2-nitrobenzoic acid(2516-95-2) |
| EPA Substance Registry System | 2516-95-2(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335-H400 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |


