2486-70-6
| Name | 4-Amino-3-methylbenzoic acid |
| CAS | 2486-70-6 |
| EINECS(EC#) | 219-629-9 |
| Molecular Formula | C8H9NO2 |
| MDL Number | MFCD00007736 |
| Molecular Weight | 151.16 |
| MOL File | 2486-70-6.mol |
Chemical Properties
| Appearance | beige or light buff to orange |
| Melting point | 169-171 °C (lit.) |
| Boiling point | 273.17°C (rough estimate) |
| density | 1.2023 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.93±0.10(Predicted) |
| color | Pale Brown to Light Brown |
| Detection Methods | HPLC,NMR |
| BRN | 2802615 |
| Stability: | Light Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H9NO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | NHFKECPTBZZFBC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N)C(C)=C1 |
| CAS DataBase Reference | 2486-70-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Amino-3-methylbenzoic acid(2486-70-6) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
