24017-47-8
| Name | Triazophos |
| CAS | 24017-47-8 |
| EINECS(EC#) | 245-986-5 |
| Molecular Formula | C12H16N3O3PS |
| MDL Number | MFCD00055327 |
| Molecular Weight | 313.31 |
| MOL File | 24017-47-8.mol |
Chemical Properties
| Melting point | 0-5°C |
| Boiling point | 260°C |
| density | 1.247 |
| vapor pressure | 3.9×10-4 Pa (30 °C) |
| Fp | 25 °C |
| storage temp. | APPROX 4°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | liquid |
| pka | -0.15±0.50(Predicted) |
| color | Light yellow to brown |
| Water Solubility | 30-40 mg/L at 20 ºC |
| BRN | 682554 |
| Henry's Law Constant | 3.2×102 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability: | Hygroscopic |
| Major Application | agriculture environmental |
| InChI | 1S/C12H16N3O3PS/c1-3-16-19(20,17-4-2)18-12-13-10-15(14-12)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | AMFGTOFWMRQMEM-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)Oc1ncn(n1)-c2ccccc2 |
| NIST Chemistry Reference | Triazophos(24017-47-8) |
Safety Data
| Hazard Codes | T;N,N,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3018 |
| WGK Germany | 3 |
| RTECS | TF5635000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29339900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 24017-47-8(Hazardous Substances Data) |
| Toxicity |