
2401-24-3
| Name | 2-Chloro-5-methoxyaniline |
| CAS | 2401-24-3 |
| EINECS(EC#) | 219-277-6 |
| Molecular Formula | C7H8ClNO |
| MDL Number | MFCD00047830 |
| Molecular Weight | 157.6 |
| MOL File | 2401-24-3.mol |
Chemical Properties
| Melting point | 207 °C (dec.)(lit.) |
| Boiling point | 135-137°C 12mm |
| density | 1.261 g/mL at 25 °C |
| refractive index | 1.5848 |
| Fp | 135-137°C/12mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to lump to clear liquid |
| pka | 2.23±0.10(Predicted) |
| color | White or Colorless to Yellow to Orange |
| Water Solubility | Slightly soluble in water. |
| BRN | 2082193 |
| InChI | InChI=1S/C7H8ClNO/c1-10-5-2-3-6(8)7(9)4-5/h2-4H,9H2,1H3 |
| InChIKey | GBOUQGUQUUPGLO-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(OC)=CC=C1Cl |
| CAS DataBase Reference | 2401-24-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312-H315-H319-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2922290090 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
