| Appearance |
green to olive-green crystalline powder |
| Melting point |
>250°C |
| Boiling point |
631.13°C (rough estimate) |
| density |
0.9659 (rough estimate) |
| refractive index |
1.6010 (estimate) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
H2O: 10 mg/mL, very deep purple
|
| Colour Index |
42600 |
| form |
powder |
| color |
Olive green |
| Odor |
Odorless |
| PH Range |
Yellow (0.0) to blue (3.5) |
| Water Solubility |
Soluble in water (10 mg/ml). |
| ε(extinction coefficient) |
≥12000 at 250-256nm in water at 0.003mg/mL ≥17000 at 304-310nm in water at 0.003mg/mL |
| λmax |
596nm |
| BRN |
4117566 |
| Stability: |
Light Sensitive |
| Major Application |
Integrated circuits, fiber-optic pH sensors, display device, inks, high-lighter, lithographic printing plates, decoder system, detergents, hair dyes, cosmetics, wound dressing materials, diagnosis of diseases caused by elemental imbalances, antimicrobial, photochemotherapeutic agent |
| Cosmetics Ingredients Functions |
HAIR DYEING |
| InChI |
1S/C31H42N3.ClH/c1-7-32(8-2)28-19-13-25(14-20-28)31(26-15-21-29(22-16-26)33(9-3)10-4)27-17-23-30(24-18-27)34(11-5)12-6;/h13-24H,7-12H2,1-6H3;1H/q+1;/p-1 |
| InChIKey |
JVICFMRAVNKDOE-UHFFFAOYSA-M |
| SMILES |
[Cl-].CCN(CC)c1ccc(cc1)C(\c2ccc(cc2)N(CC)CC)=C3/C=C\C(C=C3)=[N+](\CC)CC |
| EPA Substance Registry System |
C.I. Basic Violet 4 (2390-59-2) |