
23696-85-7
| Name | Damascenone |
| CAS | 23696-85-7 |
| EINECS(EC#) | 245-833-2 |
| Molecular Formula | C13H18O |
| MDL Number | MFCD00101024 |
| Molecular Weight | 190.28 |
| MOL File | 23696-85-7.mol |
Chemical Properties
| Boiling point | 275.6±10.0 °C(Predicted) |
| density | 0.800 |
| FEMA | 3420 |
| refractive index | 1.350-1.380 |
| Fp | 62°F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | liquid |
| color | yellow |
| Odor | at 10.00 % in dipropylene glycol. natural sweet fruity rose plum grape raspberry sugar |
| Odor Type | floral |
| JECFA Number | 387 |
| Stability: | Light Sensitive |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions | PERFUMING FRAGRANCE |
| InChI | 1S/C13H18O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5-8H,9H2,1-4H3/b7-5+ |
| InChIKey | POIARNZEYGURDG-FNORWQNLSA-N |
| SMILES | C\C=C\C(=O)C1=C(C)C=CCC1(C)C |
| LogP | 4.04 |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H317-H319 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1170 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 33021090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Skin Sens. 1 |

