22583-75-1
| Name | BENZOPHENONE-D10 |
| CAS | 22583-75-1 |
| EINECS(EC#) | 245-107-5 |
| Molecular Formula | C13D10O |
| MDL Number | MFCD00143675 |
| Molecular Weight | 192.28 |
| MOL File | 22583-75-1.mol |
Chemical Properties
| Appearance | solid |
| Melting point | 47-51 °C(lit.) |
| Boiling point | 305 °C(lit.) |
| Fp | 138℃ |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Stable. Hygroscopic. Incompatible with strong oxidising agents, strong reducing agents. |
| InChI | 1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | RWCCWEUUXYIKHB-LHNTUAQVSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C(=O)c2c([2H])c([2H])c([2H])c([2H])c2[2H] |
| CAS Number Unlabeled | 119-61-9 |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 3 Carc. 1B STOT RE 2 Oral |