
21427-61-2
| Name | 5-Chloro-2-hydroxy-3-nitropyridine |
| CAS | 21427-61-2 |
| EINECS(EC#) | 622-609-6 |
| Molecular Formula | C5H3ClN2O3 |
| MDL Number | MFCD00114884 |
| Molecular Weight | 174.54 |
| MOL File | 21427-61-2.mol |
Chemical Properties
| Melting point | 232-236 °C |
| Boiling point | 284.1±40.0 °C(Predicted) |
| density | 1.61±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 6.31±0.10(Predicted) |
| color | Light yellow to Yellow to Green |
| Detection Methods | HPLC |
| BRN | 383852 |
| InChI | 1S/C5H3ClN2O3/c6-3-1-4(8(10)11)5(9)7-2-3/h1-2H,(H,7,9) |
| InChIKey | QVGQNICXNZMXQA-UHFFFAOYSA-N |
| SMILES | Oc1ncc(Cl)cc1[N+]([O-])=O |
| CAS DataBase Reference | 21427-61-2(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |