
2106-05-0
| Name | 5-Chloro-2-fluoroaniline |
| CAS | 2106-05-0 |
| EINECS(EC#) | 218-284-1 |
| Molecular Formula | C6H5ClFN |
| MDL Number | MFCD00069416 |
| Molecular Weight | 145.56 |
| MOL File | 2106-05-0.mol |
Chemical Properties
| Boiling point | 102-105 °C/20 mmHg (lit.) |
| density | 1.29 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 219 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| pka | 2.15±0.10(Predicted) |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C6H5ClFN/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| InChIKey | JCYROOANFKVAIB-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Cl)=CC=C1F |
| CAS DataBase Reference | 2106-05-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
