
203866-13-1
| Name | N-BOC-cis-4-fluoro-L-proline |
| CAS | 203866-13-1 |
| Molecular Formula | C10H16FNO4 |
| MDL Number | MFCD04973957 |
| Molecular Weight | 233.24 |
| MOL File | 203866-13-1.mol |
Chemical Properties
| Melting point | 157-161.°C |
| Boiling point | 346.0±42.0 °C(Predicted) |
| density | 1.24±0.1 g/cm3(Predicted) |
| refractive index | -57 ° (C=1, MeOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.53±0.40(Predicted) |
| color | White to Almost white |
| Optical Rotation | [α]22/D 71.0±5°, c = 1 in chloroform |
| InChI | InChI=1S/C10H16FNO4/c1-10(2,3)16-9(15)12-5-6(11)4-7(12)8(13)14/h6-7H,4-5H2,1-3H3,(H,13,14)/t6-,7-/m0/s1 |
| InChIKey | YGWZXQOYEBWUTH-BQBZGAKWSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@@H](F)C[C@H]1C(O)=O |
| CAS DataBase Reference | 203866-13-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
