1939-36-2
| Name | 1,3-Propylenediaminetertaacetic acid |
| CAS | 1939-36-2 |
| EINECS(EC#) | 400-400-9 |
| Molecular Formula | C11H18N2O8 |
| MDL Number | MFCD00210039 |
| Molecular Weight | 306.27 |
| MOL File | 1939-36-2.mol |
Chemical Properties
| Melting point | ~250 °C (dec.) |
| Boiling point | 620.5±55.0 °C(Predicted) |
| density | 1.507±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| pka | 1.45±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1716449 |
| InChI | InChI=1S/C11H18N2O8/c14-8(15)4-12(5-9(16)17)2-1-3-13(6-10(18)19)7-11(20)21/h1-7H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | DMQQXDPCRUGSQB-UHFFFAOYSA-N |
| SMILES | C(N(CC(O)=O)CC(O)=O)CCN(CC(O)=O)CC(O)=O |
| CAS DataBase Reference | 1939-36-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1939-36-2(EPA Substance) |
Safety Data
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H318-H361 |
| Precautionary statements | P201-P280-P301+P312+P330-P305+P351+P338+P310-P308+P313 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | MC1082500 |
| TSCA | TSCA listed |
| HS Code | 2922.49.8000 |
| REACH Registrations | Inactive |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Repr. 2 |