19381-50-1
| Name | Acid Green 1 |
| CAS | 19381-50-1 |
| EINECS(EC#) | 243-010-2 |
| Molecular Formula | C30H15FeN3Na3O15S3 |
| MDL Number | MFCD00003886 |
| Molecular Weight | 878.46 |
| MOL File | 19381-50-1.mol |
Chemical Properties
| Appearance | dark green to black powder |
| bulk density | 620kg/m3 |
| storage temp. | Store at +5°C to +30°C. |
| solubility | 160g/l |
| Colour Index | 10020 |
| form | Crystalline Powder |
| color | Dark green |
| PH | 9.3 (10g/l, H2O, 20℃) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | 30 mg/mL |
| λmax | 714 nm |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| Major Application | diagnostic assay manufacturing hematology histology |
| Cosmetics Ingredients Functions | COLORANT HAIR DYEING |
| InChI | InChI=1S/3C10H7NO5S.Fe.Na/c3*12-9-4-1-6-5-7(17(14,15)16)2-3-8(6)10(9)11-13;;/h3*1-5,13H,(H,14,15,16);;/q;;;+3;+1/p-6/b3*11-10+;; |
| InChIKey | METAOVMACXXRHN-YKUQEDRPSA-H |
| SMILES | [O-]N1=C2C3C=CC(S([O-])(=O)=O)=CC=3C=CC2=O[Fe+3]231(O=C1C=CC4C=C(S([O-])(=O)=O)C=CC=4C1=N2[O-])O=C1C=CC2C=C(S([O-])(=O)=O)C=CC=2C1=N3[O-].[Na+] |
| LogP | 0.677 (est) |
| EPA Substance Registry System | Ferrate(3-), tris[5,6-dihydro-5-(hydroxyimino-. kappa.N)-6-(oxo-.kappa.O)- 2-naphthalenesulfonato(2-)]-, trisodium(19381-50-1) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H412 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P273-P501 |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | LJ8930000 |
| TSCA | Yes |
| HS Code | 32041900 |
| Storage Class | 11 - Combustible Solids |