188975-88-4
| Name | N-BOC-HEXAHYDRO-1H-AZEPIN-4-ONE |
| CAS | 188975-88-4 |
| Molecular Formula | C11H19NO3 |
| MDL Number | MFCD03788435 |
| Molecular Weight | 213.27 |
| MOL File | 188975-88-4.mol |
Chemical Properties
| Boiling point | 90-1000C/0.5mmHg |
| density | 1.072±0.06 g/cm3(Predicted) |
| refractive index | n20/D 1.467 |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform, Dichloromethane, Ethanol and Ethyl Ether. |
| form | Liquid or Low Melting Solid |
| pka | -1.50±0.20(Predicted) |
| color | Colorless to yellow |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C11H19NO3/c1-11(2,3)15-10(14)12-7-4-5-9(13)6-8-12/h4-8H2,1-3H3 |
| InChIKey | PMLBUVZPRKXMOX-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCC(=O)CC1 |
| CAS DataBase Reference | 188975-88-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
