1820573-27-0
| Name | beta-cyfluthrin (ISO): reaction mass of rel-(R)-cyano(4-fluoro-3-phenoxyphenyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate and rel-(R)-cyano(4-fluoro-3-phenoxyphenyl)methyl (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (ratio 1:2) |
| CAS | 1820573-27-0 |
| Molecular Formula | C22H18Cl2FNO3 |
| Molecular Weight | 434.29 |
| MOL File | 1820573-27-0.mol |
Chemical Properties
| Boiling point | 496.3±45.0 °C(Predicted) |
| density | 1.368±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Solid |
| color | White to off-white |
| Major Application | agriculture environmental |
| InChI | 1S/C22H18Cl2FNO3/c1-22(2)15(11-19(23)24)20(22)21(27)29-18(12-26)13-8-9-16(25)17(10-13)28-14-6-4-3-5-7-14/h3-11,15,18,20H,1-2H3 |
| InChIKey | QQODLKZGRKWIFG-UHFFFAOYSA-N |
| SMILES | CC1(C)C(\C=C(\Cl)Cl)C1C(=O)OC(C#N)c2ccc(F)c(Oc3ccccc3)c2 |
Safety Data
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300-H331-H410 |
| Precautionary statements | P273-P301+P310+P330-P304+P340+P311 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 Lact. STOT SE 1 |