179897-89-3
| Name | 5-Bromo-2-fluorobenzonitrile |
| CAS | 179897-89-3 |
| Molecular Formula | C7H3BrFN |
| MDL Number | MFCD00143424 |
| Molecular Weight | 200.01 |
| MOL File | 179897-89-3.mol |
Chemical Properties
| Appearance | white to off-white powder or crystals |
| Melting point | 76-81 °C |
| Boiling point | 220.4±20.0 °C(Predicted) |
| density | 1.7286 (rough estimate) |
| refractive index | 1.5320 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Detection Methods | GC,NMR |
| BRN | 7701063 |
| InChI | InChI=1S/C7H3BrFN/c8-6-1-2-7(9)5(3-6)4-10/h1-3H |
| InChIKey | GYCNHFWRPJXTSB-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(Br)=CC=C1F |
| CAS DataBase Reference | 179897-89-3(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |