
1747-60-0
| Name | 2-Amino-6-methoxybenzothiazole |
| CAS | 1747-60-0 |
| EINECS(EC#) | 217-130-0 |
| Molecular Formula | C8H8N2OS |
| MDL Number | MFCD00005787 |
| Molecular Weight | 180.23 |
| MOL File | 1747-60-0.mol |
Chemical Properties
| Appearance | off-white to tan-coloured powder |
| Melting point | 165-167 °C (lit.) |
| Boiling point | 240°C |
| density | 1.2425 (rough estimate) |
| refractive index | 1.5690 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | very slightly in Methanol |
| form | Crystalline Powder |
| pka | pK1: 4.50(+1) (25°C) |
| color | White to beige |
| Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| Water Solubility | <0.1 g/100 mL at 21 ºC |
| Detection Methods | HPLC |
| InChI | InChI=1S/C8H8N2OS/c1-11-5-2-3-6-7(4-5)12-8(9)10-6/h2-4H,1H3,(H2,9,10) |
| InChIKey | KZHGPDSVHSDCMX-UHFFFAOYSA-N |
| SMILES | S1C2=CC(OC)=CC=C2N=C1N |
| CAS DataBase Reference | 1747-60-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1747-60-0(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | DL2100000 |
| Hazard Note | Irritant |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29342000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |
