
17228-64-7
| Name | 2-Chloro-6-methoxypyridine |
| CAS | 17228-64-7 |
| EINECS(EC#) | 241-264-9 |
| Molecular Formula | C6H6ClNO |
| MDL Number | MFCD00006265 |
| Molecular Weight | 143.57 |
| MOL File | 17228-64-7.mol |
Chemical Properties
| Appearance | Clear colorless to light yellow liquid |
| Boiling point | 185-186 °C (lit.) |
| density | 1.207 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 169 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| pka | 0.40±0.10(Predicted) |
| color | Colorless to Almost colorless |
| BRN | 1364500 |
| InChI | InChI=1S/C6H6ClNO/c1-9-6-4-2-3-5(7)8-6/h2-4H,1H3 |
| InChIKey | VAVGOGHLNAJECD-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(OC)=CC=C1 |
| CAS DataBase Reference | 17228-64-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 2-chloro-6-methoxy-(17228-64-7) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
