1719-83-1
| Name | Bicyclo[2.2.2]oct-7-ene-2,3,5,6-tetracarboxylic acid dianhydride |
| CAS | 1719-83-1 |
| EINECS(EC#) | 217-009-2 |
| Molecular Formula | C12H8O6 |
| MDL Number | MFCD00082228 |
| Molecular Weight | 248.19 |
| MOL File | 1719-83-1.mol |
Chemical Properties
| Appearance | white to beige powder |
| Melting point | >300 °C(lit.) |
| Boiling point | 351.26°C (rough estimate) |
| density | 1.4501 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store below +30°C. |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Soluble in water |
| Sensitive | Moisture Sensitive |
| BRN | 294213 |
| InChI | InChI=1S/C12H8O6/c13-9-5-3-1-2-4(7(5)11(15)17-9)8-6(3)10(14)18-12(8)16/h1-8H |
| InChIKey | XLOGCGOPKPCECW-UHFFFAOYSA-N |
| SMILES | O1C(=O)C2C3C=CC(C4C(=O)OC(=O)C43)C2C1=O |
| CAS DataBase Reference | 1719-83-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Bicyclo[2.2.2]-7-octene-2,3,5,6-tetracarboxylic acid dianhydride(1719-83-1) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29172090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |