171335-80-1
| Name | Exatecan |
| CAS | 171335-80-1 |
| Molecular Formula | C24H22FN3O4 |
| MDL Number | MFCD00926120 |
| Molecular Weight | 435.45 |
| MOL File | 171335-80-1.mol |
Chemical Properties
| Boiling point | 818.4±65.0 °C(Predicted) |
| density | 1.53±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C,protect from light |
| solubility | Soluble in DMSO |
| form | Solid |
| pka | 11.19±0.40(Predicted) |
| color | Off-white to gray |
| InChIKey | ZVYVPGLRVWUPMP-FYSMJZIKSA-N |
| SMILES | N1C2C3=C(CC[C@H](N)C3=C3CN4C(C=13)=CC1[C@](CC)(O)C(=O)OCC=1C4=O)C(C)=C(F)C=2 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| RIDADR | UN2811 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Muta. 1B Repr. 1B |