1711-11-1
| Name | 3-Cyanobenzoyl chloride |
| CAS | 1711-11-1 |
| Molecular Formula | C8H4ClNO |
| MDL Number | MFCD00011545 |
| Molecular Weight | 165.58 |
| MOL File | 1711-11-1.mol |
Chemical Properties
| Appearance | white to pale yellow crystalline mass or light |
| Melting point | 42-44 °C(lit.) |
| Boiling point | 125-129 °C11 mm Hg(lit.) |
| density | 1.2744 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| Fp | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Crystalline Mass or Crystalline Powder and Chunks |
| color | White to pale yellow or light gray |
| InChI | InChI=1S/C8H4ClNO/c9-8(11)7-3-1-2-6(4-7)5-10/h1-4H |
| InChIKey | RPESZQVUWMFBEO-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=CC(C#N)=C1 |
Safety Data
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Skin Corr. 1B |