
169869-90-3
| Name | Exatecan mesilate |
| CAS | 169869-90-3 |
| Molecular Formula | C24H22FN3O4.CH4O3S |
| MDL Number | MFCD04113012 |
| Molecular Weight | 531.56 |
| MOL File | 169869-90-3.mol |
Chemical Properties
| storage temp. | 4°C, protect from light, stored under nitrogen |
| solubility | DMSO:7.41(Max Conc. mg/mL);13.94(Max Conc. mM) Water:0.0(Max Conc. mg/mL);0.19(Max Conc. mM) |
| form | A solid |
| color | Light yellow to green yellow |
| Stability: | Hygroscopic |
| InChIKey | BICYDYDJHSBMFS-OVCYJQQENA-N |
| SMILES | S(O)(=O)(=O)C.N[C@H]1CCC2C(C)=C(F)C=C3N=C4C5=CC6[C@@](C(=O)OCC=6C(=O)N5CC4=C1C3=2)(O)CC |&1:6,21,r| |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P310-P321-P330-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P332+P313-P337+P313-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Muta. 1B Repr. 1B |

