
16681-59-7
| Name | 2-Bromo-1-methyl-1H-imidazole |
| CAS | 16681-59-7 |
| Molecular Formula | C4H5BrN2 |
| MDL Number | MFCD02179525 |
| Molecular Weight | 161 |
| MOL File | 16681-59-7.mol |
Chemical Properties
| Boiling point | 172 °C (lit.) |
| density | 1.649 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | Liquid |
| pka | 3.83±0.25(Predicted) |
| color | Clear colorless to pale yellow to pink |
| InChI | InChI=1S/C4H5BrN2/c1-7-3-2-6-4(7)5/h2-3H,1H3 |
| InChIKey | BANOTGHIHYMTDL-UHFFFAOYSA-N |
| SMILES | C1(Br)N(C)C=CN=1 |
| CAS DataBase Reference | 16681-59-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29332990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 |

