16588-34-4
| Name | 4-Chloro-3-nitrobenzaldehyde |
| CAS | 16588-34-4 |
| EINECS(EC#) | 240-645-7 |
| Molecular Formula | C7H4ClNO3 |
| MDL Number | MFCD00007078 |
| Molecular Weight | 185.56 |
| MOL File | 16588-34-4.mol |
Chemical Properties
| Appearance | Light yellow powder |
| Melting point | 61-63 °C (lit.) |
| Boiling point | 276.5°C (rough estimate) |
| density | 1.4791 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 4g/l |
| form | Powder |
| color | Off-white to light yellow to light green |
| Water Solubility | 4 g/L (98 ºC) |
| Sensitive | Air Sensitive |
| Detection Methods | HPLC |
| BRN | 778323 |
| InChI | 1S/C7H4ClNO3/c8-6-2-1-5(4-10)3-7(6)9(11)12/h1-4H |
| InChIKey | HETBKLHJEWXWBM-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(C=O)ccc1Cl |
| CAS DataBase Reference | 16588-34-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chloro-3-nitrobenzaldehyde(16588-34-4) |
| EPA Substance Registry System | 16588-34-4(EPA Substance) |
