165047-24-5
| Name | 2,4,5-Trifluorobenzaldehyde |
| CAS | 165047-24-5 |
| EINECS(EC#) | 605-382-8 |
| Molecular Formula | C7H3F3O |
| MDL Number | MFCD00061196 |
| Molecular Weight | 160.09 |
| MOL File | 165047-24-5.mol |
Chemical Properties
| Appearance | Clear colorless to light yellow liquid |
| Boiling point | 168 °C (lit.) |
| density | 1.408 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 137 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to light yellow |
| Specific Gravity | 1.408 |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Air Sensitive |
| BRN | 8479631 |
| InChI | InChI=1S/C7H3F3O/c8-5-2-7(10)6(9)1-4(5)3-11/h1-3H |
| InChIKey | CYIFJRXFYSUBFW-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(F)=C(F)C=C1F |
| CAS DataBase Reference | 165047-24-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 1 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29130000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |