
16188-55-9
| Name | 4-Methylthiophenylacetic acid |
| CAS | 16188-55-9 |
| Molecular Formula | C9H10O2S |
| MDL Number | MFCD00192325 |
| Molecular Weight | 182.24 |
| MOL File | 16188-55-9.mol |
Chemical Properties
| Appearance | Cream crystalline powder |
| Melting point | 97-98 °C(lit.) |
| Boiling point | 337.4±25.0 °C(Predicted) |
| density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 4.34±0.10(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C9H10O2S/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | AHMLFHMRRBJCRM-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(SC)C=C1 |
| CAS DataBase Reference | 16188-55-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29309099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
