
16063-69-7
| Name | 2,4,6-Trichloropyridine |
| CAS | 16063-69-7 |
| Molecular Formula | C5H2Cl3N |
| MDL Number | MFCD00971928 |
| Molecular Weight | 182.44 |
| MOL File | 16063-69-7.mol |
Chemical Properties
| Appearance | White to off-white crystals or crystalline solid |
| Melting point | 33-37 °C(lit.) |
| Boiling point | 217.5-218.5 °C |
| density | 1.539±0.06 g/cm3(Predicted) |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| form | Crystalline Powder |
| pka | -2.93±0.10(Predicted) |
| color | Yellow to yellow-brown |
| Water Solubility | Sparingly soluble in water. (0.113 mm Hg at 25°C) |
| InChI | InChI=1S/C5H2Cl3N/c6-3-1-4(7)9-5(8)2-3/h1-2H |
| InChIKey | FJNNGKMAGDPVIU-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC(Cl)=C1 |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H317-H318 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | UU0875000 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Sens. 1 |

