15965-30-7
| Name | 4,5-Dichloroimidazole |
| CAS | 15965-30-7 |
| EINECS(EC#) | 628-571-7 |
| Molecular Formula | C3H2Cl2N2 |
| MDL Number | MFCD00005195 |
| Molecular Weight | 136.97 |
| MOL File | 15965-30-7.mol |
Chemical Properties
| Melting point | 183-185 °C (lit.) |
| Boiling point | 334.1±22.0 °C(Predicted) |
| density | 1.613±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| form | powder to crystal |
| pka | 8.99±0.10(Predicted) |
| color | White to Light yellow |
| Water Solubility | Insoluble in water. |
| BRN | 606155 |
| InChI | InChI=1S/C3H2Cl2N2/c4-2-3(5)7-1-6-2/h1H,(H,6,7) |
| InChIKey | QAJJXHRQPLATMK-UHFFFAOYSA-N |
| SMILES | C1NC(Cl)=C(Cl)N=1 |
| CAS DataBase Reference | 15965-30-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933299090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |