15574-49-9
| Name | Mecarbinate |
| CAS | 15574-49-9 |
| EINECS(EC#) | 605-026-1 |
| Molecular Formula | C13H15NO3 |
| MDL Number | MFCD00451373 |
| Molecular Weight | 233.26 |
| MOL File | 15574-49-9.mol |
Chemical Properties
| Melting point | 210.0 to 214.0 °C |
| Boiling point | 399.8±37.0 °C(Predicted) |
| density | 1.20±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | ≥ 7.1mg/mL in DMSO |
| form | powder to crystal |
| pka | 9.26±0.40(Predicted) |
| color | White to Orange to Green |
| Detection Methods | HPLC,NMR |
| InChI | InChI=1S/C13H15NO3/c1-4-17-13(16)12-8(2)14(3)11-6-5-9(15)7-10(11)12/h5-7,15H,4H2,1-3H3 |
| InChIKey | YTBNTDMBGXAOCG-UHFFFAOYSA-N |
| SMILES | N1(C)C2=C(C=C(O)C=C2)C(C(OCC)=O)=C1C |
| CAS DataBase Reference | 15574-49-9(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RTECS | NL6003600 |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Toxicity |
