
15356-60-2
| Name | (+)-MENTHOL |
| CAS | 15356-60-2 |
| EINECS(EC#) | 239-387-8 |
| Molecular Formula | C10H20O |
| MDL Number | MFCD00062983 |
| Molecular Weight | 156.27 |
| MOL File | 15356-60-2.mol |
Chemical Properties
| Melting point | 43-44 °C (lit.) |
| Boiling point | 103-104 °C/9 mmHg (lit.) |
| density | 0.890 |
| vapor pressure | 0.8 mm Hg ( 20 °C) |
| refractive index | 50 ° (C=10, EtOH) |
| Fp | 196 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 15.30±0.60(Predicted) |
| color | Colourless to Off-White Oil |
| Odor | mentholic |
| Optical Rotation | [α]23/D +48°, c = 10 in ethanol |
| Water Solubility | Soluble in methanol (almost transparency), chloroform, alcohols, water (456 mg/L at 25°C), and ether. |
| BRN | 1902292 |
| Dielectric constant | 3.2(Ambient) |
| InChI | 1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m0/s1 |
| InChIKey | NOOLISFMXDJSKH-AEJSXWLSSA-N |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1O |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 2 |
| RTECS | OT0700000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29061100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

