
15115-58-9
| Name | 3-(2-Bromophenyl)propionic acid |
| CAS | 15115-58-9 |
| Molecular Formula | C9H9BrO2 |
| MDL Number | MFCD01310791 |
| Molecular Weight | 229.07 |
| MOL File | 15115-58-9.mol |
Chemical Properties
| Melting point | 98-102 °C (lit.) |
| Boiling point | 186°C/15mmHg(lit.) |
| density | 1.531±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.60±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C9H9BrO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12) |
| InChIKey | AOACQJFIGWNQBC-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=CC=C1Br |
| CAS DataBase Reference | 15115-58-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3261 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

