
150308-80-8
| Name | N-9-fluorenylmethoxycarbonyl-Se-4-methoxybenzylselenocysteine |
| CAS | 150308-80-8 |
| Molecular Formula | C26H25NO5Se |
| MDL Number | MFCD03788170 |
| Molecular Weight | 510.44 |
| MOL File | 150308-80-8.mol |
Chemical Properties
| Boiling point | 708.5±60.0 °C(Predicted) |
| storage temp. | Store at +2°C to +8°C. |
| form | powder |
| pka | 3.50±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Optical Rotation | -35.334°(C=0.01g/ml DMF) |
| Major Application | peptide synthesis |
| InChIKey | XCPAYIZRJRMXBI-DEOSSOPVSA-N |
| SMILES | [Se](C[C@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)C(=O)O)Cc1ccc(cc1)OC |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H315-H335-H373-H410 |
| Precautionary statements | P260-P273-P301+P310-P302+P352-P304+P340+P311-P314 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible, acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Irrit. 2 STOT RE 2 STOT SE 3 |


