
14862-52-3
| Name | 1,3-Dibromo-5-chlorobenzene |
| CAS | 14862-52-3 |
| EINECS(EC#) | 627-184-0 |
| Molecular Formula | C6H3Br2Cl |
| MDL Number | MFCD00070765 |
| Molecular Weight | 270.35 |
| MOL File | 14862-52-3.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 91-94 °C (lit.) |
| Boiling point | 256 °C |
| density | 2.021±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C6H3Br2Cl/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | FNKCOUREFBNNHG-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(Cl)=CC(Br)=C1 |
| CAS DataBase Reference | 14862-52-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
