148477-71-8
| Name | Spirodiclofen |
| CAS | 148477-71-8 |
| EINECS(EC#) | 604-636-5 |
| Molecular Formula | C21H24Cl2O4 |
| MDL Number | MFCD04972571 |
| Molecular Weight | 411.32 |
| MOL File | 148477-71-8.mol |
Chemical Properties
| Melting point | 101-108° |
| Boiling point | 550.2±50.0 °C(Predicted) |
| density | 1.28±0.1 g/cm3(Predicted) |
| vapor pressure | 0-0Pa at 20-25℃ |
| Fp | 4 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), DMSO, Methanol (Sparingly) |
| form | neat |
| color | White to Off-White |
| Henry's Law Constant | 1.7×102 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | agriculture environmental |
| InChI | 1S/C21H24Cl2O4/c1-4-20(2,3)19(25)26-17-16(14-9-8-13(22)12-15(14)23)18(24)27-21(17)10-6-5-7-11-21/h8-9,12H,4-7,10-11H2,1-3H3 |
| InChIKey | DTDSAWVUFPGDMX-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C(=O)OC1=C(C(=O)OC12CCCCC2)c3ccc(Cl)cc3Cl |
| LogP | 5.83 at 20℃ and pH4 |
| EPA Substance Registry System | Spirodiclofen (148477-71-8) |
Safety Data
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H317-H350-H361f-H373-H410 |
| Precautionary statements | P201-P202-P273-P280-P302+P352-P308+P313 |
| Hazard Codes | Xi,Xn,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN1294 3/PG 2 |
| WGK Germany | 2 |
| REACH Registrations | Inactive |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 1 Carc. 1B Repr. 2 Skin Sens. 1B STOT RE 2 |
| Hazardous Substances Data | 148477-71-8(Hazardous Substances Data) |
| Toxicity |