
1478-61-1
| Name | Hexafluorobisphenol A |
| CAS | 1478-61-1 |
| EINECS(EC#) | 216-036-7 |
| Molecular Formula | C15H10F6O2 |
| MDL Number | MFCD00000439 |
| Molecular Weight | 336.23 |
| MOL File | 1478-61-1.mol |
Chemical Properties
| Appearance | white to off-white powder |
| Melting point | 160-163 °C(lit.) |
| Boiling point | 400°C |
| density | 1.3837 (estimate) |
| vapor pressure | 0Pa at 20℃ |
| Fp | >100°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | neat |
| pka | 8.74±0.10(Predicted) |
| color | White to Pale Beige |
| Water Solubility | Insoluble in water. |
| BRN | 1891568 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C15H10F6O2/c16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10/h1-8,22-23H |
| InChIKey | ZFVMWEVVKGLCIJ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C(c2ccc(O)cc2)(C(F)(F)F)C(F)(F)F |
| LogP | 2.79 at 20℃ |
| CAS DataBase Reference | 1478-61-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | SN2780000 |
| Hazard Note | Corrosive |
| TSCA | Yes |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 1478-61-1(Hazardous Substances Data) |
