
14618-80-5
| Name | (R)-(-)-Benzyl glycidyl ether |
| CAS | 14618-80-5 |
| Molecular Formula | C10H12O2 |
| MDL Number | MFCD00068409 |
| Molecular Weight | 164.2 |
| MOL File | 14618-80-5.mol |
Chemical Properties
| Appearance | Colorless to light yellow liqui |
| Melting point | 88-93°C |
| alpha | -5.4 º (c=5 in toluene) |
| Boiling point | 130 °C (0.1 mmHg) |
| density | 1.077 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| form | paste (yellow) |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.077 |
| Optical Rotation | [α]20/D 5.4°, c = 5 in toluene |
| Water Solubility | Soluble in water. |
| Detection Methods | HPLC,Optical Rotatory Dispersion |
| BRN | 3588399 |
| InChI | InChI=1S/C10H12O2/c1-2-4-9(5-3-1)6-11-7-10-8-12-10/h1-5,10H,6-8H2/t10-/m0/s1 |
| InChIKey | QNYBOILAKBSWFG-JTQLQIEISA-N |
| SMILES | O1C[C@@H]1COCC1=CC=CC=C1 |
| CAS DataBase Reference | 14618-80-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| RTECS | TX2860020 |
| REACH Registrations | Active |
| HS Code | 29109000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |
