1445251-22-8
| Name | ME0328 |
| CAS | 1445251-22-8 |
| EINECS(EC#) | 808-923-8 |
| Molecular Formula | C19H19N3O2 |
| MDL Number | MFCD27991291 |
| Molecular Weight | 321.373 |
| MOL File | 1445251-22-8.mol |
Chemical Properties
| storage temp. | room temp |
| solubility | DMSO: soluble10mg/mL, clear |
| form | powder |
| color | white to beige |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 3 months. |
| InChI | 1S/C19H19N3O2/c1-13(14-7-3-2-4-8-14)20-18(23)12-11-17-21-16-10-6-5-9-15(16)19(24)22-17/h2-10,13H,11-12H2,1H3,(H,20,23)(H,21,22,24)/t13-/m0/s1 |
| InChIKey | QIHBWVVVRYYYRO-ZDUSSCGKSA-N |
| SMILES | [nH]1c2c([c](nc1CCC(=O)N[C@@H](C)c3ccccc3)=O)cccc2 |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |