
1435-44-5
| Name | 1-CHLORO-2,4-DIFLUOROBENZENE |
| CAS | 1435-44-5 |
| EINECS(EC#) | 604-365-2 |
| Molecular Formula | C6H3ClF2 |
| MDL Number | MFCD00042569 |
| Molecular Weight | 148.54 |
| MOL File | 1435-44-5.mol |
Chemical Properties
| Appearance | Clear colourless to light yellow liquid |
| Melting point | -26 °C |
| Boiling point | 127 °C (lit.) |
| density | 1.353 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 91 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.353 |
| BRN | 2081077 |
| InChI | InChI=1S/C6H3ClF2/c7-5-2-1-4(8)3-6(5)9/h1-3H |
| InChIKey | AJCSNHQKXUSMMY-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(F)C=C1F |
| CAS DataBase Reference | 1435-44-5(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |