14348-75-5
| Name | 2,7-Dibromo-9H-fluoren-9-one |
| CAS | 14348-75-5 |
| EINECS(EC#) | 604-362-6 |
| Molecular Formula | C13H6Br2O |
| MDL Number | MFCD00010790 |
| Molecular Weight | 337.99 |
| MOL File | 14348-75-5.mol |
Chemical Properties
| Melting point | 203-205 °C (lit.) |
| Boiling point | 451.4±38.0 °C(Predicted) |
| density | 1.907±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Tetrahydrofuran |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| Detection Methods | HPLC |
| InChI | InChI=1S/C13H6Br2O/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16)11(9)5-7/h1-6H |
| InChIKey | CWGRCRZFJOXQFV-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC(Br)=C2)C2=C1C=C(Br)C=C2 |
| CAS DataBase Reference | 14348-75-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |