
1427-07-2
| Name | 2-Fluoro-4-nitrotoluene |
| CAS | 1427-07-2 |
| EINECS(EC#) | 215-845-2 |
| Molecular Formula | C7H6FNO2 |
| MDL Number | MFCD00007199 |
| Molecular Weight | 155.13 |
| MOL File | 1427-07-2.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 31-35 °C (lit.) |
| Boiling point | 65-68 °C/2 mmHg (lit.) |
| density | 1.3021 (estimate) |
| Fp | 165 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Low Melting Solid |
| color | Yellow to brown |
| Water Solubility | Insoluble in water. Solubility in methanol gives very faint turbidity. |
| FreezingPoint | 32.0 to 35.0 ℃ |
| BRN | 2250156 |
| InChI | InChI=1S/C7H6FNO2/c1-5-2-3-6(9(10)11)4-7(5)8/h2-4H,1H3 |
| InChIKey | WIQISTBTOQNVCE-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C([N+]([O-])=O)C=C1F |
| CAS DataBase Reference | 1427-07-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2-fluoro-1-methyl-4-nitro-(1427-07-2) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049085 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |