
139152-08-2
| Name | 4,5-DICHLOROPHTHALONITRILE |
| CAS | 139152-08-2 |
| Molecular Formula | C8H2Cl2N2 |
| MDL Number | MFCD00191408 |
| Molecular Weight | 197.02 |
| MOL File | 139152-08-2.mol |
Chemical Properties
| Melting point | 180-184 °C(lit.) |
| Boiling point | 312.4±42.0 °C(Predicted) |
| density | 1.48±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in hot Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C8H2Cl2N2/c9-7-1-5(3-11)6(4-12)2-8(7)10/h1-2H |
| InChIKey | SRIJSZQFAMLVQV-UHFFFAOYSA-N |
| SMILES | C1(C#N)=CC(Cl)=C(Cl)C=C1C#N |
| CAS DataBase Reference | 139152-08-2 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
