139143-09-2
| Name | 1,3-Diisopropylimidazolium chloride |
| CAS | 139143-09-2 |
| Molecular Formula | C9H17N2.Cl |
| MDL Number | MFCD02684545 |
| Molecular Weight | 188.7 |
| MOL File | 139143-09-2.mol |
Chemical Properties
| Appearance | Off-white to light beige crystalline powder |
| Melting point | 278 °C (dec.)(lit.) |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | Crystalline Powder |
| color | Off-white to light beige |
| Water Solubility | Soluble in water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C9H17N2.ClH/c1-8(2)10-5-6-11(7-10)9(3)4;/h5-9H,1-4H3;1H/q+1;/p-1 |
| InChIKey | DOFXKPAOJLLPII-UHFFFAOYSA-M |
| SMILES | [Cl-].CC(C)n1cc[n+](c1)C(C)C |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29332990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |