137504-86-0
| Name | 4-Chloro-3-fluorobenzeneboronic acid |
| CAS | 137504-86-0 |
| EINECS(EC#) | 611-583-1 |
| Molecular Formula | C6H5BClFO2 |
| MDL Number | MFCD01319010 |
| Molecular Weight | 174.37 |
| MOL File | 137504-86-0.mol |
Chemical Properties
| Appearance | Off-white Cryst |
| Melting point | 198-204℃ |
| Boiling point | 302.6±52.0 °C(Predicted) |
| density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 7.31±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C6H5BClFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H |
| InChIKey | CMJQIHGBUKZEHP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(Cl)C(F)=C1)(O)O |
| CAS DataBase Reference | 137504-86-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29319000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |