13735-81-4
| Name | 1-PHENYL-1-TRIMETHYLSILOXYETHYLENE |
| CAS | 13735-81-4 |
| EINECS(EC#) | 237-308-1 |
| Molecular Formula | C11H16OSi |
| MDL Number | MFCD00008582 |
| Molecular Weight | 192.33 |
| MOL File | 13735-81-4.mol |
Chemical Properties
| Melting point | 122-123 °C |
| Boiling point | 88-89 °C/11 mmHg (lit.) |
| density | 0.938 g/mL at 25 °C(lit.) |
| vapor density | >1 (vs air) |
| refractive index | n |
| Fp | 174 °F |
| storage temp. | −20°C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 0.938 |
| Water Solubility | Reacts with water. |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 1306914 |
| InChI | 1S/C11H16OSi/c1-10(12-13(2,3)4)11-8-6-5-7-9-11/h5-9H,1H2,2-4H3 |
| InChIKey | AFFPCIMDERUIST-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(=C)c1ccccc1 |
| CAS DataBase Reference | 13735-81-4(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, trimethyl[(1-phenylethenyl)oxy]- (13735-81-4) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HS Code | 2931900090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |