137-89-3
| Name | BIS(2-ETHYLHEXYL)ISOPHTHALATE |
| CAS | 137-89-3 |
| EINECS(EC#) | 205-308-0 |
| Molecular Formula | C24H38O4 |
| MDL Number | MFCD00152284 |
| Molecular Weight | 390.56 |
| MOL File | 137-89-3.mol |
Chemical Properties
| Melting point | -46 |
| Boiling point | 211°C/2mmHg(lit.) |
| density | 1.0101 (rough estimate) |
| refractive index | 1.4860 to 1.4900 |
| Fp | 233°C(lit.) |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | neat |
| color | Colourless |
| Water Solubility | 11ug/L(24 ºC) |
| BRN | 2162836 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C24H38O4/c1-5-9-12-19(7-3)17-27-23(25)21-14-11-15-22(16-21)24(26)28-18-20(8-4)13-10-6-2/h11,14-16,19-20H,5-10,12-13,17-18H2,1-4H3 |
| InChIKey | WXZOXVVKILCOPG-UHFFFAOYSA-N |
| SMILES | O(CC(CCCC)CC)C(=O)c1cc(ccc1)C(=O)OCC(CCCC)CC |
| EPA Substance Registry System | Bis(2-ethylhexyl) isophthalate (137-89-3) |
Safety Data
| Hazard Codes | T,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| RTECS | NT2050000 |
| TSCA | TSCA listed |
| HS Code | 2917.39.7000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Repr. 1B |