
136849-72-4
| Name | TOTU |
| CAS | 136849-72-4 |
| EINECS(EC#) | 629-020-3 |
| Molecular Formula | C10H17BF4N4O3 |
| MDL Number | MFCD00192127 |
| Molecular Weight | 328.07 |
| MOL File | 136849-72-4.mol |
Chemical Properties
| Appearance | white to yellowish crystalline powder |
| Melting point | 145 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | Soluble in water or 1% acetic acid |
| form | Crystalline Powder |
| color | White to yellow |
| Sensitive | Moisture Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H17N4O3.BF4/c1-6-16-9(15)8(7-11)12-17-10(13(2)3)14(4)5;2-1(3,4)5/h6H2,1-5H3;/q+1;-1/b12-8-; |
| InChIKey | PZOBERLGEQHZDV-BPWZRWDXSA-M |
| SMILES | C(=[N+](/C)\C)(\N(C)C)/O/N=C(/C#N)\C(=O)OCC.[B-](F)(F)(F)F |
| CAS DataBase Reference | 136849-72-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1759 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Sens. 1A STOT SE 3 |
| Toxicity |
